Organic compounds
Organic compounds are a class of chemical compounds that contain one or more atoms of carbon covalently bonded to each other and atoms of other elements such as hydrogen, oxygen, nitrogen, sulfur, etc.
Compounds or allotropes of carbon that contain only carbon atoms are classified as inorganic compounds and exhibit novel properties.
This class of chemicals has a wide range of applications and includes graphite, diamond, and the more recently discovered graphene, fullerenes, and other carbon nanotubes. In fact, the majority of elements in the periodic table of elements are inorganic compounds.
Filtered Search Results
Cholesterol, ≥99%, MP Biomedicals™
CAS: 57-88-5 Molecular Formula: C27H46O Molecular Weight (g/mol): 386.664 MDL Number: MFCD00003646 InChI Key: HVYWMOMLDIMFJA-DPAQBDIFSA-N Synonym: cholesterol,cholesterin,cholest-5-en-3beta-ol,cholesteryl alcohol,cholestrin,cordulan,dusoline,dusoran,provitamin d,cholesterine PubChem CID: 5997 ChEBI: CHEBI:16113 IUPAC Name: (3S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol SMILES: CC(C)CCCC(C)C1CCC2C1(CCC3C2CC=C4C3(CCC(C4)O)C)C
| PubChem CID | 5997 |
|---|---|
| CAS | 57-88-5 |
| Molecular Weight (g/mol) | 386.664 |
| ChEBI | CHEBI:16113 |
| MDL Number | MFCD00003646 |
| SMILES | CC(C)CCCC(C)C1CCC2C1(CCC3C2CC=C4C3(CCC(C4)O)C)C |
| Synonym | cholesterol,cholesterin,cholest-5-en-3beta-ol,cholesteryl alcohol,cholestrin,cordulan,dusoline,dusoran,provitamin d,cholesterine |
| IUPAC Name | (3S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
| InChI Key | HVYWMOMLDIMFJA-DPAQBDIFSA-N |
| Molecular Formula | C27H46O |
2,2,4-Trimethyl-1,3-pentanediol 1-monoisobutyrate
CAS: 25265-77-4 Molecular Formula: C12H24O3 Molecular Weight (g/mol): 216.321 MDL Number: MFCD00148967 InChI Key: DAFHKNAQFPVRKR-UHFFFAOYSA-N Synonym: texanol,2,2,4-trimethyl-1,3-pentanediol monoisobutyrate,chissocizer cs 12,propanoic acid, 2-methyl-, 3-hydroxy-2,2,4-trimethylpentyl ester,2,2,4-trimethylpentane-1,3-diol monoisobutyrate,3-hydroxy-2,2,4-trimethylpentyl isobutyrate,ccris 8966,isobutyraldehyde tishchenko trimer,propanoic acid, 2-methyl-, monoester with 2,2,4-trimethyl-1,3-pentanediol,2,2,4-trimethyl-1,3-pentanediolmono 2-methylpropanoate PubChem CID: 6490 IUPAC Name: (3-hydroxy-2,2,4-trimethylpentyl) 2-methylpropanoate SMILES: CC(C)C(C(C)(C)COC(=O)C(C)C)O
| PubChem CID | 6490 |
|---|---|
| CAS | 25265-77-4 |
| Molecular Weight (g/mol) | 216.321 |
| MDL Number | MFCD00148967 |
| SMILES | CC(C)C(C(C)(C)COC(=O)C(C)C)O |
| Synonym | texanol,2,2,4-trimethyl-1,3-pentanediol monoisobutyrate,chissocizer cs 12,propanoic acid, 2-methyl-, 3-hydroxy-2,2,4-trimethylpentyl ester,2,2,4-trimethylpentane-1,3-diol monoisobutyrate,3-hydroxy-2,2,4-trimethylpentyl isobutyrate,ccris 8966,isobutyraldehyde tishchenko trimer,propanoic acid, 2-methyl-, monoester with 2,2,4-trimethyl-1,3-pentanediol,2,2,4-trimethyl-1,3-pentanediolmono 2-methylpropanoate |
| IUPAC Name | (3-hydroxy-2,2,4-trimethylpentyl) 2-methylpropanoate |
| InChI Key | DAFHKNAQFPVRKR-UHFFFAOYSA-N |
| Molecular Formula | C12H24O3 |
1,10-Phenanthroline, 99+%
CAS: 66-71-7 Molecular Formula: C12H8N2 Molecular Weight (g/mol): 180.21 MDL Number: MFCD00011678 InChI Key: DGEZNRSVGBDHLK-UHFFFAOYSA-N Synonym: o-phenanthroline,4,5-diazaphenanthrene,orthophenanthroline,phenanthroline,1,10-o-phenanthroline,phen,2-phenanthroline,beta-phenanthroline,anhydrous,.beta.-phenanthroline PubChem CID: 1318 ChEBI: CHEBI:44975 IUPAC Name: 1,10-phenanthroline SMILES: C1=CC2=C(C3=C(C=CC=N3)C=C2)N=C1
| PubChem CID | 1318 |
|---|---|
| CAS | 66-71-7 |
| Molecular Weight (g/mol) | 180.21 |
| ChEBI | CHEBI:44975 |
| MDL Number | MFCD00011678 |
| SMILES | C1=CC2=C(C3=C(C=CC=N3)C=C2)N=C1 |
| Synonym | o-phenanthroline,4,5-diazaphenanthrene,orthophenanthroline,phenanthroline,1,10-o-phenanthroline,phen,2-phenanthroline,beta-phenanthroline,anhydrous,.beta.-phenanthroline |
| IUPAC Name | 1,10-phenanthroline |
| InChI Key | DGEZNRSVGBDHLK-UHFFFAOYSA-N |
| Molecular Formula | C12H8N2 |
Potassium citrate tribasic monohydrate, 99%, extra pure
CAS: 6100-05-6 Molecular Formula: C6H5K3O7·H2O Molecular Weight (g/mol): 324.42 InChI Key: PJAHUDTUZRZBKM-UHFFFAOYSA-K Synonym: potassium citrate monohydrate,tripotassium citrate monohydrate,unii-ee90oni6ff,ee90oni6ff,citric acid tripotassium salt,urocit-k,ccris 6543,tri-potassium citrate monohydrate,potassium citrate tribasic monohydrate,citric acid, tripotassium salt, monohydrate PubChem CID: 2735208 ChEBI: CHEBI:64746 IUPAC Name: tripotassium;2-hydroxypropane-1,2,3-tricarboxylate;hydrate SMILES: C(C(=O)[O-])C(CC(=O)[O-])(C(=O)[O-])O.O.[K+].[K+].[K+]
| PubChem CID | 2735208 |
|---|---|
| CAS | 6100-05-6 |
| Molecular Weight (g/mol) | 324.42 |
| ChEBI | CHEBI:64746 |
| SMILES | C(C(=O)[O-])C(CC(=O)[O-])(C(=O)[O-])O.O.[K+].[K+].[K+] |
| Synonym | potassium citrate monohydrate,tripotassium citrate monohydrate,unii-ee90oni6ff,ee90oni6ff,citric acid tripotassium salt,urocit-k,ccris 6543,tri-potassium citrate monohydrate,potassium citrate tribasic monohydrate,citric acid, tripotassium salt, monohydrate |
| IUPAC Name | tripotassium;2-hydroxypropane-1,2,3-tricarboxylate;hydrate |
| InChI Key | PJAHUDTUZRZBKM-UHFFFAOYSA-K |
| Molecular Formula | C6H5K3O7·H2O |
Poly(ethylene glycol), average M.W. 200
CAS: 25322-68-3 Molecular Formula: (C2H4O)n Molecular Weight (g/mol): 62.07 MDL Number: MFCD01779601 InChI Key: LYCAIKOWRPUZTN-UHFFFAOYSA-N Synonym: PEG IUPAC Name: ethane-1,2-diol SMILES: [H]OCCO
| CAS | 25322-68-3 |
|---|---|
| Molecular Weight (g/mol) | 62.07 |
| MDL Number | MFCD01779601 |
| SMILES | [H]OCCO |
| Synonym | PEG |
| IUPAC Name | ethane-1,2-diol |
| InChI Key | LYCAIKOWRPUZTN-UHFFFAOYSA-N |
| Molecular Formula | (C2H4O)n |
Acrylic acid, low water content, 99.5%, stab. with ca 200ppm 4-methoxyphenol
CAS: 79-10-7 Molecular Formula: C3H4O2 Molecular Weight (g/mol): 72.063 MDL Number: MFCD00004367 InChI Key: NIXOWILDQLNWCW-UHFFFAOYSA-N Synonym: acrylic acid,2-propenoic acid,propenoic acid,vinylformic acid,acroleic acid,propene acid,ethylenecarboxylic acid,polyacrylate,propenoate,carbomer PubChem CID: 6581 ChEBI: CHEBI:18308 IUPAC Name: prop-2-enoic acid SMILES: C=CC(=O)O
| PubChem CID | 6581 |
|---|---|
| CAS | 79-10-7 |
| Molecular Weight (g/mol) | 72.063 |
| ChEBI | CHEBI:18308 |
| MDL Number | MFCD00004367 |
| SMILES | C=CC(=O)O |
| Synonym | acrylic acid,2-propenoic acid,propenoic acid,vinylformic acid,acroleic acid,propene acid,ethylenecarboxylic acid,polyacrylate,propenoate,carbomer |
| IUPAC Name | prop-2-enoic acid |
| InChI Key | NIXOWILDQLNWCW-UHFFFAOYSA-N |
| Molecular Formula | C3H4O2 |
alpha-Ketoglutaric acid disodium salt dihydrate, 99%
CAS: 305-72-6 Molecular Formula: C5H4Na2O5 Molecular Weight (g/mol): 190.062 MDL Number: MFCD00150702 InChI Key: YBGBJYVHJTVUSL-UHFFFAOYSA-L Synonym: disodium 2-oxoglutarate,unii-flp7p4rm46,disodium 2-oxopentanedioate,flp7p4rm46,pentanedioic acid, 2-oxo-, disodium salt,2-oxoglutaric acid disodium salt,2-ketoglutaric acid disodium salt,alpha-ketoglutaric acid sodium salt,disodium ? ketoglutarate,disodium oxoglurate PubChem CID: 31040 IUPAC Name: disodium;2-oxopentanedioate SMILES: C(CC(=O)[O-])C(=O)C(=O)[O-].[Na+].[Na+]
| PubChem CID | 31040 |
|---|---|
| CAS | 305-72-6 |
| Molecular Weight (g/mol) | 190.062 |
| MDL Number | MFCD00150702 |
| SMILES | C(CC(=O)[O-])C(=O)C(=O)[O-].[Na+].[Na+] |
| Synonym | disodium 2-oxoglutarate,unii-flp7p4rm46,disodium 2-oxopentanedioate,flp7p4rm46,pentanedioic acid, 2-oxo-, disodium salt,2-oxoglutaric acid disodium salt,2-ketoglutaric acid disodium salt,alpha-ketoglutaric acid sodium salt,disodium ? ketoglutarate,disodium oxoglurate |
| IUPAC Name | disodium;2-oxopentanedioate |
| InChI Key | YBGBJYVHJTVUSL-UHFFFAOYSA-L |
| Molecular Formula | C5H4Na2O5 |
Ethyl formate, 97%
CAS: 109-94-4 Molecular Formula: C3H6O2 Molecular Weight (g/mol): 74.08 MDL Number: MFCD00003294 InChI Key: WBJINCZRORDGAQ-UHFFFAOYSA-N Synonym: areginal,formic acid, ethyl ester,ethyl methanoate,formic acid ethyl ester,aethylformiat,ethyl formic ester,ethylformate,ethylformiaat,formic ether,ethylformiat PubChem CID: 8025 ChEBI: CHEBI:52342 IUPAC Name: ethyl formate SMILES: CCOC=O
| PubChem CID | 8025 |
|---|---|
| CAS | 109-94-4 |
| Molecular Weight (g/mol) | 74.08 |
| ChEBI | CHEBI:52342 |
| MDL Number | MFCD00003294 |
| SMILES | CCOC=O |
| Synonym | areginal,formic acid, ethyl ester,ethyl methanoate,formic acid ethyl ester,aethylformiat,ethyl formic ester,ethylformate,ethylformiaat,formic ether,ethylformiat |
| IUPAC Name | ethyl formate |
| InChI Key | WBJINCZRORDGAQ-UHFFFAOYSA-N |
| Molecular Formula | C3H6O2 |
2,2,2-Trifluoroethanol, 99.8%, extra pure
CAS: 75-89-8 Molecular Formula: C2H3F3O Molecular Weight (g/mol): 100.04 MDL Number: MFCD00004672 InChI Key: RHQDFWAXVIIEBN-UHFFFAOYSA-N Synonym: trifluoroethanol,ethanol, 2,2,2-trifluoro,2,2,2-trifluoroethan-1-ol,fluorinol 85,2,2,2-trifluoroethyl alcohol,trifluoroethyl alcohol,trifluoro ethanol,tfe,perfluoro-1,1-dihydroethanol,tfetoh PubChem CID: 6409 ChEBI: CHEBI:42330 IUPAC Name: 2,2,2-trifluoroethanol SMILES: OCC(F)(F)F
| PubChem CID | 6409 |
|---|---|
| CAS | 75-89-8 |
| Molecular Weight (g/mol) | 100.04 |
| ChEBI | CHEBI:42330 |
| MDL Number | MFCD00004672 |
| SMILES | OCC(F)(F)F |
| Synonym | trifluoroethanol,ethanol, 2,2,2-trifluoro,2,2,2-trifluoroethan-1-ol,fluorinol 85,2,2,2-trifluoroethyl alcohol,trifluoroethyl alcohol,trifluoro ethanol,tfe,perfluoro-1,1-dihydroethanol,tfetoh |
| IUPAC Name | 2,2,2-trifluoroethanol |
| InChI Key | RHQDFWAXVIIEBN-UHFFFAOYSA-N |
| Molecular Formula | C2H3F3O |
4-Nitrobenzaldehyde, 99%
CAS: 555-16-8 Molecular Formula: C7H5NO3 Molecular Weight (g/mol): 151.12 MDL Number: MFCD00007346 InChI Key: BXRFQSNOROATLV-UHFFFAOYSA-N Synonym: p-nitrobenzaldehyde,benzaldehyde, 4-nitro,p-formylnitrobenzene,benzaldehyde, p-nitro,4-nitrobenzaldehydde,4-nitro-benzaldehyde,4-formylnitrobenzene,p-nitro benzaldehyde,4-nitro benzaldehyde,ccris 1675 PubChem CID: 541 ChEBI: CHEBI:66926 IUPAC Name: 4-nitrobenzaldehyde SMILES: [O-][N+](=O)C1=CC=C(C=O)C=C1
| PubChem CID | 541 |
|---|---|
| CAS | 555-16-8 |
| Molecular Weight (g/mol) | 151.12 |
| ChEBI | CHEBI:66926 |
| MDL Number | MFCD00007346 |
| SMILES | [O-][N+](=O)C1=CC=C(C=O)C=C1 |
| Synonym | p-nitrobenzaldehyde,benzaldehyde, 4-nitro,p-formylnitrobenzene,benzaldehyde, p-nitro,4-nitrobenzaldehydde,4-nitro-benzaldehyde,4-formylnitrobenzene,p-nitro benzaldehyde,4-nitro benzaldehyde,ccris 1675 |
| IUPAC Name | 4-nitrobenzaldehyde |
| InChI Key | BXRFQSNOROATLV-UHFFFAOYSA-N |
| Molecular Formula | C7H5NO3 |
Carbon Tetrachloride, 99%, Thermo Scientific™
CAS: 56-23-5 Molecular Formula: CCl4 Molecular Weight (g/mol): 153.81 MDL Number: MFCD00000785 InChI Key: VZGDMQKNWNREIO-UHFFFAOYSA-N Synonym: carbon tetrachloride,perchloromethane,tetrasol,methane, tetrachloro,vermoestricid,benzinoform,necatorine,tetrafinol,carbona,univerm PubChem CID: 5943 ChEBI: CHEBI:27385 IUPAC Name: tetrachloromethane SMILES: ClC(Cl)(Cl)Cl
| PubChem CID | 5943 |
|---|---|
| CAS | 56-23-5 |
| Molecular Weight (g/mol) | 153.81 |
| ChEBI | CHEBI:27385 |
| MDL Number | MFCD00000785 |
| SMILES | ClC(Cl)(Cl)Cl |
| Synonym | carbon tetrachloride,perchloromethane,tetrasol,methane, tetrachloro,vermoestricid,benzinoform,necatorine,tetrafinol,carbona,univerm |
| IUPAC Name | tetrachloromethane |
| InChI Key | VZGDMQKNWNREIO-UHFFFAOYSA-N |
| Molecular Formula | CCl4 |
Tetramethylsilane, 99.9+%, NMR grade
CAS: 75-76-3 Molecular Formula: C4H12Si Molecular Weight (g/mol): 88.23 MDL Number: MFCD00008274 InChI Key: CZDYPVPMEAXLPK-UHFFFAOYSA-N Synonym: silane, tetramethyl,tetramethylsilicane,tetramethyl silane,silicon, tetramethyl,tetramethyl-silane,unii-41y0rbg14q,me4si,ch3 4si,si ch3 4,chembl68073 PubChem CID: 6396 ChEBI: CHEBI:85361 IUPAC Name: tetramethylsilane SMILES: C[Si](C)(C)C
| PubChem CID | 6396 |
|---|---|
| CAS | 75-76-3 |
| Molecular Weight (g/mol) | 88.23 |
| ChEBI | CHEBI:85361 |
| MDL Number | MFCD00008274 |
| SMILES | C[Si](C)(C)C |
| Synonym | silane, tetramethyl,tetramethylsilicane,tetramethyl silane,silicon, tetramethyl,tetramethyl-silane,unii-41y0rbg14q,me4si,ch3 4si,si ch3 4,chembl68073 |
| IUPAC Name | tetramethylsilane |
| InChI Key | CZDYPVPMEAXLPK-UHFFFAOYSA-N |
| Molecular Formula | C4H12Si |
Betaine, 5M Solution, Molecular Biology Grade, Ultrapure
CAS: 107-43-7 Molecular Formula: C5H11NO2 Molecular Weight (g/mol): 117.148 MDL Number: MFCD00012123 InChI Key: KWIUHFFTVRNATP-UHFFFAOYSA-N Synonym: betaine,glycine betaine,oxyneurine,lycine,trimethylglycine,abromine,trimethylglycocoll,glycylbetaine,glycocoll betaine,acidin-pepsin PubChem CID: 247 ChEBI: CHEBI:17750 IUPAC Name: 2-(trimethylazaniumyl)acetate SMILES: C[N+](C)(C)CC(=O)[O-]
| PubChem CID | 247 |
|---|---|
| CAS | 107-43-7 |
| Molecular Weight (g/mol) | 117.148 |
| ChEBI | CHEBI:17750 |
| MDL Number | MFCD00012123 |
| SMILES | C[N+](C)(C)CC(=O)[O-] |
| Synonym | betaine,glycine betaine,oxyneurine,lycine,trimethylglycine,abromine,trimethylglycocoll,glycylbetaine,glycocoll betaine,acidin-pepsin |
| IUPAC Name | 2-(trimethylazaniumyl)acetate |
| InChI Key | KWIUHFFTVRNATP-UHFFFAOYSA-N |
| Molecular Formula | C5H11NO2 |
Acetophenone, 99%
CAS: 98-86-2 Molecular Formula: C8H8O Molecular Weight (g/mol): 120.151 MDL Number: MFCD00008724 InChI Key: KWOLFJPFCHCOCG-UHFFFAOYSA-N Synonym: acetophenone,methyl phenyl ketone,acetylbenzene,phenyl methyl ketone,ethanone, 1-phenyl,hypnone,benzoyl methide,acetophenon,1-phenylethan-1-one,acetylbenzol PubChem CID: 7410 ChEBI: CHEBI:27632 IUPAC Name: 1-phenylethanone SMILES: CC(=O)C1=CC=CC=C1
| PubChem CID | 7410 |
|---|---|
| CAS | 98-86-2 |
| Molecular Weight (g/mol) | 120.151 |
| ChEBI | CHEBI:27632 |
| MDL Number | MFCD00008724 |
| SMILES | CC(=O)C1=CC=CC=C1 |
| Synonym | acetophenone,methyl phenyl ketone,acetylbenzene,phenyl methyl ketone,ethanone, 1-phenyl,hypnone,benzoyl methide,acetophenon,1-phenylethan-1-one,acetylbenzol |
| IUPAC Name | 1-phenylethanone |
| InChI Key | KWOLFJPFCHCOCG-UHFFFAOYSA-N |
| Molecular Formula | C8H8O |
Benzophenone, 99+%, pure
CAS: 119-61-9 Molecular Formula: C13H10O Molecular Weight (g/mol): 182.22 InChI Key: RWCCWEUUXYIKHB-UHFFFAOYSA-N Synonym: benzophenone,diphenyl ketone,benzoylbenzene,phenyl ketone,methanone, diphenyl,alpha-oxoditane,ketone, diphenyl,benzene, benzoyl,alpha-oxodiphenylmethane,diphenylketone PubChem CID: 3102 ChEBI: CHEBI:41308 IUPAC Name: diphenylmethanone SMILES: C1=CC=C(C=C1)C(=O)C2=CC=CC=C2
| PubChem CID | 3102 |
|---|---|
| CAS | 119-61-9 |
| Molecular Weight (g/mol) | 182.22 |
| ChEBI | CHEBI:41308 |
| SMILES | C1=CC=C(C=C1)C(=O)C2=CC=CC=C2 |
| Synonym | benzophenone,diphenyl ketone,benzoylbenzene,phenyl ketone,methanone, diphenyl,alpha-oxoditane,ketone, diphenyl,benzene, benzoyl,alpha-oxodiphenylmethane,diphenylketone |
| IUPAC Name | diphenylmethanone |
| InChI Key | RWCCWEUUXYIKHB-UHFFFAOYSA-N |
| Molecular Formula | C13H10O |